C15H18N2OS2 — CID 8725605
1-[(4-methoxyphenyl)methyl]-3-[(1S)-1-thiophen-2-ylethyl]thiourea (PubChem CID 8725605) has the molecular formula C15H18N2OS2 and a molecular weight of 306.46 g/mol. Its IUPAC name is 1-[(4-methoxyphenyl)methyl]-3-[(1S)-1-thiophen-2-ylethyl]thiourea.
| Compound Name | 1-[(4-methoxyphenyl)methyl]-3-[(1S)-1-thiophen-2-ylethyl]thiourea |
|---|---|
| PubChem CID | 8725605 |
| Molecular Formula | C15H18N2OS2 |
| Molecular Weight | 306.46 g/mol |
| Exact Mass | 306.09 |
| IUPAC Name | 1-[(4-methoxyphenyl)methyl]-3-[(1S)-1-thiophen-2-ylethyl]thiourea |
| SMILES | COc1ccc(CNC(=S)N[C@@H](C)c2cccs2)cc1 |
| InChI | InChI=1S/C15H18N2OS2/c1-11(14-4-3-9-20-14)17-15(19)16-10-12-5-7-13(18-2)8-6-12/h3-9,11H,10H2,1-2H3,(H2,16,17,19)/t11-/m0/s1 |
| InChIKey | YBFKMGOLFVBMIG-NSHDSACASA-N |
| XLogP | 3.48 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.46 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|