C17H19N3O3S2 — CID 9478932
1-[(4-methoxyphenyl)methyl]-3-[(4-oxo-4-thiophen-2-ylbutanoyl)amino]thiourea (PubChem CID 9478932) has the molecular formula C17H19N3O3S2 and a molecular weight of 377.49 g/mol. Its IUPAC name is 1-[(4-methoxyphenyl)methyl]-3-[(4-oxo-4-thiophen-2-ylbutanoyl)amino]thiourea.
| Compound Name | 1-[(4-methoxyphenyl)methyl]-3-[(4-oxo-4-thiophen-2-ylbutanoyl)amino]thiourea |
|---|---|
| PubChem CID | 9478932 |
| Molecular Formula | C17H19N3O3S2 |
| Molecular Weight | 377.49 g/mol |
| Exact Mass | 377.09 |
| IUPAC Name | 1-[(4-methoxyphenyl)methyl]-3-[(4-oxo-4-thiophen-2-ylbutanoyl)amino]thiourea |
| SMILES | COc1ccc(CNC(=S)NNC(=O)CCC(=O)c2cccs2)cc1 |
| InChI | InChI=1S/C17H19N3O3S2/c1-23-13-6-4-12(5-7-13)11-18-17(24)20-19-16(22)9-8-14(21)15-3-2-10-25-15/h2-7,10H,8-9,11H2,1H3,(H,19,22)(H2,18,20,24) |
| InChIKey | XHTNTBDZIOUAOP-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.49 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|