C16H16N2O3S — CID 108743971
4-[[(4-oxo-4-thiophen-2-ylbutanoyl)amino]methyl]benzamide (PubChem CID 108743971) has the molecular formula C16H16N2O3S and a molecular weight of 316.38 g/mol. Its IUPAC name is 4-[[(4-oxo-4-thiophen-2-ylbutanoyl)amino]methyl]benzamide.
| Compound Name | 4-[[(4-oxo-4-thiophen-2-ylbutanoyl)amino]methyl]benzamide |
|---|---|
| PubChem CID | 108743971 |
| Molecular Formula | C16H16N2O3S |
| Molecular Weight | 316.38 g/mol |
| Exact Mass | 316.09 |
| IUPAC Name | 4-[[(4-oxo-4-thiophen-2-ylbutanoyl)amino]methyl]benzamide |
| SMILES | NC(=O)c1ccc(CNC(=O)CCC(=O)c2cccs2)cc1 |
| InChI | InChI=1S/C16H16N2O3S/c17-16(21)12-5-3-11(4-6-12)10-18-15(20)8-7-13(19)14-2-1-9-22-14/h1-6,9H,7-8,10H2,(H2,17,21)(H,18,20) |
| InChIKey | ROHQXRDNWXJFRE-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.38 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |