C16H14F3NO2S — CID 18168670
4-oxo-4-thiophen-2-yl-N-[[3-(trifluoromethyl)phenyl]methyl]butanamide (PubChem CID 18168670) has the molecular formula C16H14F3NO2S and a molecular weight of 341.35 g/mol. Its IUPAC name is 4-oxo-4-thiophen-2-yl-N-[[3-(trifluoromethyl)phenyl]methyl]butanamide.
| Compound Name | 4-oxo-4-thiophen-2-yl-N-[[3-(trifluoromethyl)phenyl]methyl]butanamide |
|---|---|
| PubChem CID | 18168670 |
| Molecular Formula | C16H14F3NO2S |
| Molecular Weight | 341.35 g/mol |
| Exact Mass | 341.07 |
| IUPAC Name | 4-oxo-4-thiophen-2-yl-N-[[3-(trifluoromethyl)phenyl]methyl]butanamide |
| SMILES | O=C(CCC(=O)c1cccs1)NCc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C16H14F3NO2S/c17-16(18,19)12-4-1-3-11(9-12)10-20-15(22)7-6-13(21)14-5-2-8-23-14/h1-5,8-9H,6-7,10H2,(H,20,22) |
| InChIKey | BPERYNPOVPELCA-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.35 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |