C20H14F3NO2S — CID 39948631
2-(thiophene-2-carbonyl)-N-[[3-(trifluoromethyl)phenyl]methyl]benzamide (PubChem CID 39948631) has the molecular formula C20H14F3NO2S and a molecular weight of 389.40 g/mol. Its IUPAC name is 2-(thiophene-2-carbonyl)-N-[[3-(trifluoromethyl)phenyl]methyl]benzamide.
| Compound Name | 2-(thiophene-2-carbonyl)-N-[[3-(trifluoromethyl)phenyl]methyl]benzamide |
|---|---|
| PubChem CID | 39948631 |
| Molecular Formula | C20H14F3NO2S |
| Molecular Weight | 389.40 g/mol |
| Exact Mass | 389.07 |
| IUPAC Name | 2-(thiophene-2-carbonyl)-N-[[3-(trifluoromethyl)phenyl]methyl]benzamide |
| SMILES | O=C(NCc1cccc(C(F)(F)F)c1)c1ccccc1C(=O)c1cccs1 |
| InChI | InChI=1S/C20H14F3NO2S/c21-20(22,23)14-6-3-5-13(11-14)12-24-19(26)16-8-2-1-7-15(16)18(25)17-9-4-10-27-17/h1-11H,12H2,(H,24,26) |
| InChIKey | UMUVWTWHZDNYBC-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.40 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |