C22H14F3NO2S — CID 31825077
2-(thiophene-2-carbonyl)-N-[3-[3-(trifluoromethyl)phenyl]prop-2-ynyl]benzamide (PubChem CID 31825077) has the molecular formula C22H14F3NO2S and a molecular weight of 413.42 g/mol. Its IUPAC name is 2-(thiophene-2-carbonyl)-N-[3-[3-(trifluoromethyl)phenyl]prop-2-ynyl]benzamide.
| Compound Name | 2-(thiophene-2-carbonyl)-N-[3-[3-(trifluoromethyl)phenyl]prop-2-ynyl]benzamide |
|---|---|
| PubChem CID | 31825077 |
| Molecular Formula | C22H14F3NO2S |
| Molecular Weight | 413.42 g/mol |
| Exact Mass | 413.07 |
| IUPAC Name | 2-(thiophene-2-carbonyl)-N-[3-[3-(trifluoromethyl)phenyl]prop-2-ynyl]benzamide |
| SMILES | O=C(NCC#Cc1cccc(C(F)(F)F)c1)c1ccccc1C(=O)c1cccs1 |
| InChI | InChI=1S/C22H14F3NO2S/c23-22(24,25)16-8-3-6-15(14-16)7-4-12-26-21(28)18-10-2-1-9-17(18)20(27)19-11-5-13-29-19/h1-3,5-6,8-11,13-14H,12H2,(H,26,28) |
| InChIKey | DEJJKXSIHRMNCT-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.42 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|