C15H9ClF3NOS — CID 90550637
5-chloro-N-[3-[3-(trifluoromethyl)phenyl]prop-2-ynyl]thiophene-2-carboxamide (PubChem CID 90550637) has the molecular formula C15H9ClF3NOS and a molecular weight of 343.76 g/mol. Its IUPAC name is 5-chloro-N-[3-[3-(trifluoromethyl)phenyl]prop-2-ynyl]thiophene-2-carboxamide.
| Compound Name | 5-chloro-N-[3-[3-(trifluoromethyl)phenyl]prop-2-ynyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 90550637 |
| Molecular Formula | C15H9ClF3NOS |
| Molecular Weight | 343.76 g/mol |
| Exact Mass | 343.00 |
| IUPAC Name | 5-chloro-N-[3-[3-(trifluoromethyl)phenyl]prop-2-ynyl]thiophene-2-carboxamide |
| SMILES | O=C(NCC#Cc1cccc(C(F)(F)F)c1)c1ccc(Cl)s1 |
| InChI | InChI=1S/C15H9ClF3NOS/c16-13-7-6-12(22-13)14(21)20-8-2-4-10-3-1-5-11(9-10)15(17,18)19/h1,3,5-7,9H,8H2,(H,20,21) |
| InChIKey | JPLQXHJJAAOWHG-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.76 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|