C19H16F3NO — CID 90550585
2-(3-methylphenyl)-N-[3-[3-(trifluoromethyl)phenyl]prop-2-ynyl]acetamide (PubChem CID 90550585) has the molecular formula C19H16F3NO and a molecular weight of 331.34 g/mol. Its IUPAC name is 2-(3-methylphenyl)-N-[3-[3-(trifluoromethyl)phenyl]prop-2-ynyl]acetamide.
| Compound Name | 2-(3-methylphenyl)-N-[3-[3-(trifluoromethyl)phenyl]prop-2-ynyl]acetamide |
|---|---|
| PubChem CID | 90550585 |
| Molecular Formula | C19H16F3NO |
| Molecular Weight | 331.34 g/mol |
| Exact Mass | 331.12 |
| IUPAC Name | 2-(3-methylphenyl)-N-[3-[3-(trifluoromethyl)phenyl]prop-2-ynyl]acetamide |
| SMILES | Cc1cccc(CC(=O)NCC#Cc2cccc(C(F)(F)F)c2)c1 |
| InChI | InChI=1S/C19H16F3NO/c1-14-5-2-7-16(11-14)13-18(24)23-10-4-8-15-6-3-9-17(12-15)19(20,21)22/h2-3,5-7,9,11-12H,10,13H2,1H3,(H,23,24) |
| InChIKey | ICBGQFVCXRXZQW-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.34 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|