C18H15F3N2O — CID 90553760
1-benzyl-3-[3-[3-(trifluoromethyl)phenyl]prop-2-ynyl]urea (PubChem CID 90553760) has the molecular formula C18H15F3N2O and a molecular weight of 332.33 g/mol. Its IUPAC name is 1-benzyl-3-[3-[3-(trifluoromethyl)phenyl]prop-2-ynyl]urea.
| Compound Name | 1-benzyl-3-[3-[3-(trifluoromethyl)phenyl]prop-2-ynyl]urea |
|---|---|
| PubChem CID | 90553760 |
| Molecular Formula | C18H15F3N2O |
| Molecular Weight | 332.33 g/mol |
| Exact Mass | 332.11 |
| IUPAC Name | 1-benzyl-3-[3-[3-(trifluoromethyl)phenyl]prop-2-ynyl]urea |
| SMILES | O=C(NCC#Cc1cccc(C(F)(F)F)c1)NCc1ccccc1 |
| InChI | InChI=1S/C18H15F3N2O/c19-18(20,21)16-10-4-8-14(12-16)9-5-11-22-17(24)23-13-15-6-2-1-3-7-15/h1-4,6-8,10,12H,11,13H2,(H2,22,23,24) |
| InChIKey | WTNAXRDHIOJLPE-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.33 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|