C18H23F3N2O2 — CID 86994312
1-[3-(2-methylpropoxy)propyl]-3-[3-[3-(trifluoromethyl)phenyl]prop-2-ynyl]urea (PubChem CID 86994312) has the molecular formula C18H23F3N2O2 and a molecular weight of 356.39 g/mol. Its IUPAC name is 1-[3-(2-methylpropoxy)propyl]-3-[3-[3-(trifluoromethyl)phenyl]prop-2-ynyl]urea.
| Compound Name | 1-[3-(2-methylpropoxy)propyl]-3-[3-[3-(trifluoromethyl)phenyl]prop-2-ynyl]urea |
|---|---|
| PubChem CID | 86994312 |
| Molecular Formula | C18H23F3N2O2 |
| Molecular Weight | 356.39 g/mol |
| Exact Mass | 356.17 |
| IUPAC Name | 1-[3-(2-methylpropoxy)propyl]-3-[3-[3-(trifluoromethyl)phenyl]prop-2-ynyl]urea |
| SMILES | CC(C)COCCCNC(=O)NCC#Cc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C18H23F3N2O2/c1-14(2)13-25-11-5-10-23-17(24)22-9-4-7-15-6-3-8-16(12-15)18(19,20)21/h3,6,8,12,14H,5,9-11,13H2,1-2H3,(H2,22,23,24) |
| InChIKey | GXRVGAIXHUEOQJ-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.39 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|