C16H19F3N2O — CID 78856359
1-pentyl-3-[3-[3-(trifluoromethyl)phenyl]prop-2-ynyl]urea (PubChem CID 78856359) has the molecular formula C16H19F3N2O and a molecular weight of 312.34 g/mol. Its IUPAC name is 1-pentyl-3-[3-[3-(trifluoromethyl)phenyl]prop-2-ynyl]urea.
| Compound Name | 1-pentyl-3-[3-[3-(trifluoromethyl)phenyl]prop-2-ynyl]urea |
|---|---|
| PubChem CID | 78856359 |
| Molecular Formula | C16H19F3N2O |
| Molecular Weight | 312.34 g/mol |
| Exact Mass | 312.14 |
| IUPAC Name | 1-pentyl-3-[3-[3-(trifluoromethyl)phenyl]prop-2-ynyl]urea |
| SMILES | CCCCCNC(=O)NCC#Cc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C16H19F3N2O/c1-2-3-4-10-20-15(22)21-11-6-8-13-7-5-9-14(12-13)16(17,18)19/h5,7,9,12H,2-4,10-11H2,1H3,(H2,20,21,22) |
| InChIKey | URGPITJKMONNLD-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.34 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|