C21H17F4N3O — CID 86874101
1-[2-(6-fluoro-1H-indol-3-yl)ethyl]-3-[3-[3-(trifluoromethyl)phenyl]prop-2-ynyl]urea (PubChem CID 86874101) has the molecular formula C21H17F4N3O and a molecular weight of 403.38 g/mol. Its IUPAC name is 1-[2-(6-fluoro-1H-indol-3-yl)ethyl]-3-[3-[3-(trifluoromethyl)phenyl]prop-2-ynyl]urea.
| Compound Name | 1-[2-(6-fluoro-1H-indol-3-yl)ethyl]-3-[3-[3-(trifluoromethyl)phenyl]prop-2-ynyl]urea |
|---|---|
| PubChem CID | 86874101 |
| Molecular Formula | C21H17F4N3O |
| Molecular Weight | 403.38 g/mol |
| Exact Mass | 403.13 |
| IUPAC Name | 1-[2-(6-fluoro-1H-indol-3-yl)ethyl]-3-[3-[3-(trifluoromethyl)phenyl]prop-2-ynyl]urea |
| SMILES | O=C(NCC#Cc1cccc(C(F)(F)F)c1)NCCc1c[nH]c2cc(F)ccc12 |
| InChI | InChI=1S/C21H17F4N3O/c22-17-6-7-18-15(13-28-19(18)12-17)8-10-27-20(29)26-9-2-4-14-3-1-5-16(11-14)21(23,24)25/h1,3,5-7,11-13,28H,8-10H2,(H2,26,27,29) |
| InChIKey | UPWGZMGZAPEXRL-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 56.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.38 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|