C18H26FN5O — CID 111887695
N-[2-[[N-[2-(6-fluoro-1H-indol-3-yl)ethyl]-N'-methylcarbamimidoyl]amino]ethyl]-2-methylpropanamide (PubChem CID 111887695) has the molecular formula C18H26FN5O and a molecular weight of 347.44 g/mol. Its IUPAC name is N-[2-[[N-[2-(6-fluoro-1H-indol-3-yl)ethyl]-N'-methylcarbamimidoyl]amino]ethyl]-2-methylpropanamide.
| Compound Name | N-[2-[[N-[2-(6-fluoro-1H-indol-3-yl)ethyl]-N'-methylcarbamimidoyl]amino]ethyl]-2-methylpropanamide |
|---|---|
| PubChem CID | 111887695 |
| Molecular Formula | C18H26FN5O |
| Molecular Weight | 347.44 g/mol |
| Exact Mass | 347.21 |
| IUPAC Name | N-[2-[[N-[2-(6-fluoro-1H-indol-3-yl)ethyl]-N'-methylcarbamimidoyl]amino]ethyl]-2-methylpropanamide |
| SMILES | C/N=C(\NCCNC(=O)C(C)C)NCCc1c[nH]c2cc(F)ccc12 |
| InChI | InChI=1S/C18H26FN5O/c1-12(2)17(25)21-8-9-23-18(20-3)22-7-6-13-11-24-16-10-14(19)4-5-15(13)16/h4-5,10-12,24H,6-9H2,1-3H3,(H,21,25)(H2,20,22,23) |
| InChIKey | LHGAWXBEWVOCFS-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 81.31 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.44 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|