C20H27FN4 — CID 111691028
1-(2,2-dicyclopropylethyl)-3-[2-(6-fluoro-1H-indol-3-yl)ethyl]-2-methylguanidine (PubChem CID 111691028) has the molecular formula C20H27FN4 and a molecular weight of 342.46 g/mol. Its IUPAC name is 1-(2,2-dicyclopropylethyl)-3-[2-(6-fluoro-1H-indol-3-yl)ethyl]-2-methylguanidine.
| Compound Name | 1-(2,2-dicyclopropylethyl)-3-[2-(6-fluoro-1H-indol-3-yl)ethyl]-2-methylguanidine |
|---|---|
| PubChem CID | 111691028 |
| Molecular Formula | C20H27FN4 |
| Molecular Weight | 342.46 g/mol |
| Exact Mass | 342.22 |
| IUPAC Name | 1-(2,2-dicyclopropylethyl)-3-[2-(6-fluoro-1H-indol-3-yl)ethyl]-2-methylguanidine |
| SMILES | C/N=C(/NCCc1c[nH]c2cc(F)ccc12)NCC(C1CC1)C1CC1 |
| InChI | InChI=1S/C20H27FN4/c1-22-20(25-12-18(13-2-3-13)14-4-5-14)23-9-8-15-11-24-19-10-16(21)6-7-17(15)19/h6-7,10-11,13-14,18,24H,2-5,8-9,12H2,1H3,(H2,22,23,25) |
| InChIKey | LNPYFNCARUTVTC-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 52.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.46 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|