C23H33FN6O — CID 111566957
1-[2-[4-(cyclobutanecarbonyl)piperazin-1-yl]ethyl]-3-[2-(6-fluoro-1H-indol-3-yl)ethyl]-2-methylguanidine (PubChem CID 111566957) has the molecular formula C23H33FN6O and a molecular weight of 428.56 g/mol. Its IUPAC name is 1-[2-[4-(cyclobutanecarbonyl)piperazin-1-yl]ethyl]-3-[2-(6-fluoro-1H-indol-3-yl)ethyl]-2-methylguanidine.
| Compound Name | 1-[2-[4-(cyclobutanecarbonyl)piperazin-1-yl]ethyl]-3-[2-(6-fluoro-1H-indol-3-yl)ethyl]-2-methylguanidine |
|---|---|
| PubChem CID | 111566957 |
| Molecular Formula | C23H33FN6O |
| Molecular Weight | 428.56 g/mol |
| Exact Mass | 428.27 |
| IUPAC Name | 1-[2-[4-(cyclobutanecarbonyl)piperazin-1-yl]ethyl]-3-[2-(6-fluoro-1H-indol-3-yl)ethyl]-2-methylguanidine |
| SMILES | C/N=C(/NCCc1c[nH]c2cc(F)ccc12)NCCN1CCN(C(=O)C2CCC2)CC1 |
| InChI | InChI=1S/C23H33FN6O/c1-25-23(26-8-7-18-16-28-21-15-19(24)5-6-20(18)21)27-9-10-29-11-13-30(14-12-29)22(31)17-3-2-4-17/h5-6,15-17,28H,2-4,7-14H2,1H3,(H2,25,26,27) |
| InChIKey | GFVZMFPJPTUUMR-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 75.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.56 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|