C20H31FN6 — CID 111973498
1-[2-(5-fluoro-1H-indol-3-yl)ethyl]-2-methyl-3-[2-(4-methyl-1,4-diazepan-1-yl)ethyl]guanidine (PubChem CID 111973498) has the molecular formula C20H31FN6 and a molecular weight of 374.51 g/mol. Its IUPAC name is 1-[2-(5-fluoro-1H-indol-3-yl)ethyl]-2-methyl-3-[2-(4-methyl-1,4-diazepan-1-yl)ethyl]guanidine.
| Compound Name | 1-[2-(5-fluoro-1H-indol-3-yl)ethyl]-2-methyl-3-[2-(4-methyl-1,4-diazepan-1-yl)ethyl]guanidine |
|---|---|
| PubChem CID | 111973498 |
| Molecular Formula | C20H31FN6 |
| Molecular Weight | 374.51 g/mol |
| Exact Mass | 374.26 |
| IUPAC Name | 1-[2-(5-fluoro-1H-indol-3-yl)ethyl]-2-methyl-3-[2-(4-methyl-1,4-diazepan-1-yl)ethyl]guanidine |
| SMILES | C/N=C(/NCCc1c[nH]c2ccc(F)cc12)NCCN1CCCN(C)CC1 |
| InChI | InChI=1S/C20H31FN6/c1-22-20(24-8-11-27-10-3-9-26(2)12-13-27)23-7-6-16-15-25-19-5-4-17(21)14-18(16)19/h4-5,14-15,25H,3,6-13H2,1-2H3,(H2,22,23,24) |
| InChIKey | RRKDPQVDKWQKIM-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 58.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.51 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|