C24H30FN5 — CID 111788775
1-[2-(5-fluoro-1H-indol-3-yl)ethyl]-2-methyl-3-[[4-(pyrrolidin-1-ylmethyl)phenyl]methyl]guanidine (PubChem CID 111788775) has the molecular formula C24H30FN5 and a molecular weight of 407.54 g/mol. Its IUPAC name is 1-[2-(5-fluoro-1H-indol-3-yl)ethyl]-2-methyl-3-[[4-(pyrrolidin-1-ylmethyl)phenyl]methyl]guanidine.
| Compound Name | 1-[2-(5-fluoro-1H-indol-3-yl)ethyl]-2-methyl-3-[[4-(pyrrolidin-1-ylmethyl)phenyl]methyl]guanidine |
|---|---|
| PubChem CID | 111788775 |
| Molecular Formula | C24H30FN5 |
| Molecular Weight | 407.54 g/mol |
| Exact Mass | 407.25 |
| IUPAC Name | 1-[2-(5-fluoro-1H-indol-3-yl)ethyl]-2-methyl-3-[[4-(pyrrolidin-1-ylmethyl)phenyl]methyl]guanidine |
| SMILES | C/N=C(/NCCc1c[nH]c2ccc(F)cc12)NCc1ccc(CN2CCCC2)cc1 |
| InChI | InChI=1S/C24H30FN5/c1-26-24(27-11-10-20-16-28-23-9-8-21(25)14-22(20)23)29-15-18-4-6-19(7-5-18)17-30-12-2-3-13-30/h4-9,14,16,28H,2-3,10-13,15,17H2,1H3,(H2,26,27,29) |
| InChIKey | CYHMEKOWADQPLU-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 55.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.54 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|