C20H30FN5O — CID 111972570
1-[2-(5-fluoro-1H-indol-3-yl)ethyl]-2-methyl-3-(4-morpholin-4-ylbutyl)guanidine (PubChem CID 111972570) has the molecular formula C20H30FN5O and a molecular weight of 375.49 g/mol. Its IUPAC name is 1-[2-(5-fluoro-1H-indol-3-yl)ethyl]-2-methyl-3-(4-morpholin-4-ylbutyl)guanidine.
| Compound Name | 1-[2-(5-fluoro-1H-indol-3-yl)ethyl]-2-methyl-3-(4-morpholin-4-ylbutyl)guanidine |
|---|---|
| PubChem CID | 111972570 |
| Molecular Formula | C20H30FN5O |
| Molecular Weight | 375.49 g/mol |
| Exact Mass | 375.24 |
| IUPAC Name | 1-[2-(5-fluoro-1H-indol-3-yl)ethyl]-2-methyl-3-(4-morpholin-4-ylbutyl)guanidine |
| SMILES | C/N=C(\NCCCCN1CCOCC1)NCCc1c[nH]c2ccc(F)cc12 |
| InChI | InChI=1S/C20H30FN5O/c1-22-20(23-7-2-3-9-26-10-12-27-13-11-26)24-8-6-16-15-25-19-5-4-17(21)14-18(16)19/h4-5,14-15,25H,2-3,6-13H2,1H3,(H2,22,23,24) |
| InChIKey | MPVUZYUJUAYIBW-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.49 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|