C22H34FIN6O2 — CID 111547780
2-[[[2-(5-fluoro-1H-indol-3-yl)ethylamino]-(3-morpholin-4-ylpropylamino)methylidene]amino]-N,N-dimethylacetamide;hydroiodide (PubChem CID 111547780) has the molecular formula C22H34FIN6O2 and a molecular weight of 560.46 g/mol. Its IUPAC name is 2-[[[2-(5-fluoro-1H-indol-3-yl)ethylamino]-(3-morpholin-4-ylpropylamino)methylidene]amino]-N,N-dimethylacetamide;hydroiodide.
| Compound Name | 2-[[[2-(5-fluoro-1H-indol-3-yl)ethylamino]-(3-morpholin-4-ylpropylamino)methylidene]amino]-N,N-dimethylacetamide;hydroiodide |
|---|---|
| PubChem CID | 111547780 |
| Molecular Formula | C22H34FIN6O2 |
| Molecular Weight | 560.46 g/mol |
| Exact Mass | 560.18 |
| IUPAC Name | 2-[[[2-(5-fluoro-1H-indol-3-yl)ethylamino]-(3-morpholin-4-ylpropylamino)methylidene]amino]-N,N-dimethylacetamide;hydroiodide |
| SMILES | CN(C)C(=O)C/N=C(\NCCCN1CCOCC1)NCCc1c[nH]c2ccc(F)cc12.I |
| InChI | InChI=1S/C22H33FN6O2.HI/c1-28(2)21(30)16-27-22(24-7-3-9-29-10-12-31-13-11-29)25-8-6-17-15-26-20-5-4-18(23)14-19(17)20;/h4-5,14-15,26H,3,6-13,16H2,1-2H3,(H2,24,25,27);1H |
| InChIKey | CBWBFNJISJNSPV-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 84.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.46 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|