C20H32F2IN5O2 — CID 111323785
2-[[[1-(2,4-difluorophenyl)ethylamino]-(3-morpholin-4-ylpropylamino)methylidene]amino]-N,N-dimethylacetamide;hydroiodide (PubChem CID 111323785) has the molecular formula C20H32F2IN5O2 and a molecular weight of 539.41 g/mol. Its IUPAC name is 2-[[[1-(2,4-difluorophenyl)ethylamino]-(3-morpholin-4-ylpropylamino)methylidene]amino]-N,N-dimethylacetamide;hydroiodide.
| Compound Name | 2-[[[1-(2,4-difluorophenyl)ethylamino]-(3-morpholin-4-ylpropylamino)methylidene]amino]-N,N-dimethylacetamide;hydroiodide |
|---|---|
| PubChem CID | 111323785 |
| Molecular Formula | C20H32F2IN5O2 |
| Molecular Weight | 539.41 g/mol |
| Exact Mass | 539.16 |
| IUPAC Name | 2-[[[1-(2,4-difluorophenyl)ethylamino]-(3-morpholin-4-ylpropylamino)methylidene]amino]-N,N-dimethylacetamide;hydroiodide |
| SMILES | CC(N/C(=N/CC(=O)N(C)C)NCCCN1CCOCC1)c1ccc(F)cc1F.I |
| InChI | InChI=1S/C20H31F2N5O2.HI/c1-15(17-6-5-16(21)13-18(17)22)25-20(24-14-19(28)26(2)3)23-7-4-8-27-9-11-29-12-10-27;/h5-6,13,15H,4,7-12,14H2,1-3H3,(H2,23,24,25);1H |
| InChIKey | DTJOFNSISCLNFB-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 69.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.41 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|