C23H35N7O2 — CID 110042683
N,N-dimethyl-2-[[(3-morpholin-4-ylpropylamino)-[1-(3-pyrazol-1-ylphenyl)ethylamino]methylidene]amino]acetamide (PubChem CID 110042683) has the molecular formula C23H35N7O2 and a molecular weight of 441.58 g/mol. Its IUPAC name is N,N-dimethyl-2-[[(3-morpholin-4-ylpropylamino)-[1-(3-pyrazol-1-ylphenyl)ethylamino]methylidene]amino]acetamide.
| Compound Name | N,N-dimethyl-2-[[(3-morpholin-4-ylpropylamino)-[1-(3-pyrazol-1-ylphenyl)ethylamino]methylidene]amino]acetamide |
|---|---|
| PubChem CID | 110042683 |
| Molecular Formula | C23H35N7O2 |
| Molecular Weight | 441.58 g/mol |
| Exact Mass | 441.29 |
| IUPAC Name | N,N-dimethyl-2-[[(3-morpholin-4-ylpropylamino)-[1-(3-pyrazol-1-ylphenyl)ethylamino]methylidene]amino]acetamide |
| SMILES | CC(N/C(=N/CC(=O)N(C)C)NCCCN1CCOCC1)c1cccc(-n2cccn2)c1 |
| InChI | InChI=1S/C23H35N7O2/c1-19(20-7-4-8-21(17-20)30-12-6-10-26-30)27-23(25-18-22(31)28(2)3)24-9-5-11-29-13-15-32-16-14-29/h4,6-8,10,12,17,19H,5,9,11,13-16,18H2,1-3H3,(H2,24,25,27) |
| InChIKey | SEYOABLBWKQDRB-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 87.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.58 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|