C20H31Cl2N5O2 — CID 111310646
2-[[[1-(2,4-dichlorophenyl)ethylamino]-(3-morpholin-4-ylpropylamino)methylidene]amino]-N,N-dimethylacetamide (PubChem CID 111310646) has the molecular formula C20H31Cl2N5O2 and a molecular weight of 444.41 g/mol. Its IUPAC name is 2-[[[1-(2,4-dichlorophenyl)ethylamino]-(3-morpholin-4-ylpropylamino)methylidene]amino]-N,N-dimethylacetamide.
| Compound Name | 2-[[[1-(2,4-dichlorophenyl)ethylamino]-(3-morpholin-4-ylpropylamino)methylidene]amino]-N,N-dimethylacetamide |
|---|---|
| PubChem CID | 111310646 |
| Molecular Formula | C20H31Cl2N5O2 |
| Molecular Weight | 444.41 g/mol |
| Exact Mass | 443.19 |
| IUPAC Name | 2-[[[1-(2,4-dichlorophenyl)ethylamino]-(3-morpholin-4-ylpropylamino)methylidene]amino]-N,N-dimethylacetamide |
| SMILES | CC(N/C(=N/CC(=O)N(C)C)NCCCN1CCOCC1)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C20H31Cl2N5O2/c1-15(17-6-5-16(21)13-18(17)22)25-20(24-14-19(28)26(2)3)23-7-4-8-27-9-11-29-12-10-27/h5-6,13,15H,4,7-12,14H2,1-3H3,(H2,23,24,25) |
| InChIKey | UABAJZRELDWPEH-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 69.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.41 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|