C15H22Cl2N4O — CID 111310408
3-[[N-[1-(2,4-dichlorophenyl)ethyl]-N'-methylcarbamimidoyl]amino]-N,N-dimethylpropanamide (PubChem CID 111310408) has the molecular formula C15H22Cl2N4O and a molecular weight of 345.27 g/mol. Its IUPAC name is 3-[[N-[1-(2,4-dichlorophenyl)ethyl]-N'-methylcarbamimidoyl]amino]-N,N-dimethylpropanamide.
| Compound Name | 3-[[N-[1-(2,4-dichlorophenyl)ethyl]-N'-methylcarbamimidoyl]amino]-N,N-dimethylpropanamide |
|---|---|
| PubChem CID | 111310408 |
| Molecular Formula | C15H22Cl2N4O |
| Molecular Weight | 345.27 g/mol |
| Exact Mass | 344.12 |
| IUPAC Name | 3-[[N-[1-(2,4-dichlorophenyl)ethyl]-N'-methylcarbamimidoyl]amino]-N,N-dimethylpropanamide |
| SMILES | C/N=C(\NCCC(=O)N(C)C)NC(C)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C15H22Cl2N4O/c1-10(12-6-5-11(16)9-13(12)17)20-15(18-2)19-8-7-14(22)21(3)4/h5-6,9-10H,7-8H2,1-4H3,(H2,18,19,20) |
| InChIKey | XEZRPANTDMEIGQ-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.27 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|