C15H24Cl2IN3O3S — CID 111515123
1-[1-(2,4-dichlorophenyl)ethyl]-2-methyl-3-[2-(2-methylsulfonylethoxy)ethyl]guanidine;hydroiodide (PubChem CID 111515123) has the molecular formula C15H24Cl2IN3O3S and a molecular weight of 524.25 g/mol. Its IUPAC name is 1-[1-(2,4-dichlorophenyl)ethyl]-2-methyl-3-[2-(2-methylsulfonylethoxy)ethyl]guanidine;hydroiodide.
| Compound Name | 1-[1-(2,4-dichlorophenyl)ethyl]-2-methyl-3-[2-(2-methylsulfonylethoxy)ethyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111515123 |
| Molecular Formula | C15H24Cl2IN3O3S |
| Molecular Weight | 524.25 g/mol |
| Exact Mass | 523.00 |
| IUPAC Name | 1-[1-(2,4-dichlorophenyl)ethyl]-2-methyl-3-[2-(2-methylsulfonylethoxy)ethyl]guanidine;hydroiodide |
| SMILES | C/N=C(\NCCOCCS(C)(=O)=O)NC(C)c1ccc(Cl)cc1Cl.I |
| InChI | InChI=1S/C15H23Cl2N3O3S.HI/c1-11(13-5-4-12(16)10-14(13)17)20-15(18-2)19-6-7-23-8-9-24(3,21)22;/h4-5,10-11H,6-9H2,1-3H3,(H2,18,19,20);1H |
| InChIKey | ILZVBXLQWQUPHD-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 79.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.25 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|