C19H28IN3O3S — CID 111516260
2-methyl-1-[2-(2-methylsulfonylethoxy)ethyl]-3-(1-naphthalen-1-ylethyl)guanidine;hydroiodide (PubChem CID 111516260) has the molecular formula C19H28IN3O3S and a molecular weight of 505.42 g/mol. Its IUPAC name is 2-methyl-1-[2-(2-methylsulfonylethoxy)ethyl]-3-(1-naphthalen-1-ylethyl)guanidine;hydroiodide.
| Compound Name | 2-methyl-1-[2-(2-methylsulfonylethoxy)ethyl]-3-(1-naphthalen-1-ylethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111516260 |
| Molecular Formula | C19H28IN3O3S |
| Molecular Weight | 505.42 g/mol |
| Exact Mass | 505.09 |
| IUPAC Name | 2-methyl-1-[2-(2-methylsulfonylethoxy)ethyl]-3-(1-naphthalen-1-ylethyl)guanidine;hydroiodide |
| SMILES | C/N=C(\NCCOCCS(C)(=O)=O)NC(C)c1cccc2ccccc12.I |
| InChI | InChI=1S/C19H27N3O3S.HI/c1-15(17-10-6-8-16-7-4-5-9-18(16)17)22-19(20-2)21-11-12-25-13-14-26(3,23)24;/h4-10,15H,11-14H2,1-3H3,(H2,20,21,22);1H |
| InChIKey | QNBZQSCWJAQKFW-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 79.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.42 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|