C21H37N3O5S — CID 111517173
1-[1-(3,4-dipropoxyphenyl)ethyl]-2-methyl-3-[2-(2-methylsulfonylethoxy)ethyl]guanidine (PubChem CID 111517173) has the molecular formula C21H37N3O5S and a molecular weight of 443.61 g/mol. Its IUPAC name is 1-[1-(3,4-dipropoxyphenyl)ethyl]-2-methyl-3-[2-(2-methylsulfonylethoxy)ethyl]guanidine.
| Compound Name | 1-[1-(3,4-dipropoxyphenyl)ethyl]-2-methyl-3-[2-(2-methylsulfonylethoxy)ethyl]guanidine |
|---|---|
| PubChem CID | 111517173 |
| Molecular Formula | C21H37N3O5S |
| Molecular Weight | 443.61 g/mol |
| Exact Mass | 443.25 |
| IUPAC Name | 1-[1-(3,4-dipropoxyphenyl)ethyl]-2-methyl-3-[2-(2-methylsulfonylethoxy)ethyl]guanidine |
| SMILES | CCCOc1ccc(C(C)N/C(=N/C)NCCOCCS(C)(=O)=O)cc1OCCC |
| InChI | InChI=1S/C21H37N3O5S/c1-6-11-28-19-9-8-18(16-20(19)29-12-7-2)17(3)24-21(22-4)23-10-13-27-14-15-30(5,25)26/h8-9,16-17H,6-7,10-15H2,1-5H3,(H2,22,23,24) |
| InChIKey | JMQYWQJTKLLVDR-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 98.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.61 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|