C23H41IN4O3 — CID 111363324
N-[2-[[N-[1-(3,4-dipropoxyphenyl)ethyl]-N'-methylcarbamimidoyl]amino]ethyl]-2,2-dimethylpropanamide;hydroiodide (PubChem CID 111363324) has the molecular formula C23H41IN4O3 and a molecular weight of 548.51 g/mol. Its IUPAC name is N-[2-[[N-[1-(3,4-dipropoxyphenyl)ethyl]-N'-methylcarbamimidoyl]amino]ethyl]-2,2-dimethylpropanamide;hydroiodide.
| Compound Name | N-[2-[[N-[1-(3,4-dipropoxyphenyl)ethyl]-N'-methylcarbamimidoyl]amino]ethyl]-2,2-dimethylpropanamide;hydroiodide |
|---|---|
| PubChem CID | 111363324 |
| Molecular Formula | C23H41IN4O3 |
| Molecular Weight | 548.51 g/mol |
| Exact Mass | 548.22 |
| IUPAC Name | N-[2-[[N-[1-(3,4-dipropoxyphenyl)ethyl]-N'-methylcarbamimidoyl]amino]ethyl]-2,2-dimethylpropanamide;hydroiodide |
| SMILES | CCCOc1ccc(C(C)N/C(=N/C)NCCNC(=O)C(C)(C)C)cc1OCCC.I |
| InChI | InChI=1S/C23H40N4O3.HI/c1-8-14-29-19-11-10-18(16-20(19)30-15-9-2)17(3)27-22(24-7)26-13-12-25-21(28)23(4,5)6;/h10-11,16-17H,8-9,12-15H2,1-7H3,(H,25,28)(H2,24,26,27);1H |
| InChIKey | VYOOBFXGSGSEOX-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.51 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|