C20H36IN3O5S — CID 111514737
1-[1-(3,4-diethoxyphenyl)ethyl]-3-ethyl-2-[2-(2-methylsulfonylethoxy)ethyl]guanidine;hydroiodide (PubChem CID 111514737) has the molecular formula C20H36IN3O5S and a molecular weight of 557.50 g/mol. Its IUPAC name is 1-[1-(3,4-diethoxyphenyl)ethyl]-3-ethyl-2-[2-(2-methylsulfonylethoxy)ethyl]guanidine;hydroiodide.
| Compound Name | 1-[1-(3,4-diethoxyphenyl)ethyl]-3-ethyl-2-[2-(2-methylsulfonylethoxy)ethyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111514737 |
| Molecular Formula | C20H36IN3O5S |
| Molecular Weight | 557.50 g/mol |
| Exact Mass | 557.14 |
| IUPAC Name | 1-[1-(3,4-diethoxyphenyl)ethyl]-3-ethyl-2-[2-(2-methylsulfonylethoxy)ethyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\CCOCCS(C)(=O)=O)NC(C)c1ccc(OCC)c(OCC)c1.I |
| InChI | InChI=1S/C20H35N3O5S.HI/c1-6-21-20(22-11-12-26-13-14-29(5,24)25)23-16(4)17-9-10-18(27-7-2)19(15-17)28-8-3;/h9-10,15-16H,6-8,11-14H2,1-5H3,(H2,21,22,23);1H |
| InChIKey | MDRTWHUIZAPLAD-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 98.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.50 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|