C18H31N3O4S — CID 111297717
1-[1-(3,4-diethoxyphenyl)ethyl]-3-ethyl-2-(2-methylsulfonylethyl)guanidine (PubChem CID 111297717) has the molecular formula C18H31N3O4S and a molecular weight of 385.53 g/mol. Its IUPAC name is 1-[1-(3,4-diethoxyphenyl)ethyl]-3-ethyl-2-(2-methylsulfonylethyl)guanidine.
| Compound Name | 1-[1-(3,4-diethoxyphenyl)ethyl]-3-ethyl-2-(2-methylsulfonylethyl)guanidine |
|---|---|
| PubChem CID | 111297717 |
| Molecular Formula | C18H31N3O4S |
| Molecular Weight | 385.53 g/mol |
| Exact Mass | 385.20 |
| IUPAC Name | 1-[1-(3,4-diethoxyphenyl)ethyl]-3-ethyl-2-(2-methylsulfonylethyl)guanidine |
| SMILES | CCN/C(=N\CCS(C)(=O)=O)NC(C)c1ccc(OCC)c(OCC)c1 |
| InChI | InChI=1S/C18H31N3O4S/c1-6-19-18(20-11-12-26(5,22)23)21-14(4)15-9-10-16(24-7-2)17(13-15)25-8-3/h9-10,13-14H,6-8,11-12H2,1-5H3,(H2,19,20,21) |
| InChIKey | IKHGYYFOVGZRGV-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 89.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.53 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|