C24H34N4O3 — CID 111297829
4-[[[[1-(3,4-diethoxyphenyl)ethylamino]-(ethylamino)methylidene]amino]methyl]-N-methylbenzamide (PubChem CID 111297829) has the molecular formula C24H34N4O3 and a molecular weight of 426.56 g/mol. Its IUPAC name is 4-[[[[1-(3,4-diethoxyphenyl)ethylamino]-(ethylamino)methylidene]amino]methyl]-N-methylbenzamide.
| Compound Name | 4-[[[[1-(3,4-diethoxyphenyl)ethylamino]-(ethylamino)methylidene]amino]methyl]-N-methylbenzamide |
|---|---|
| PubChem CID | 111297829 |
| Molecular Formula | C24H34N4O3 |
| Molecular Weight | 426.56 g/mol |
| Exact Mass | 426.26 |
| IUPAC Name | 4-[[[[1-(3,4-diethoxyphenyl)ethylamino]-(ethylamino)methylidene]amino]methyl]-N-methylbenzamide |
| SMILES | CCN/C(=N\Cc1ccc(C(=O)NC)cc1)NC(C)c1ccc(OCC)c(OCC)c1 |
| InChI | InChI=1S/C24H34N4O3/c1-6-26-24(27-16-18-9-11-19(12-10-18)23(29)25-5)28-17(4)20-13-14-21(30-7-2)22(15-20)31-8-3/h9-15,17H,6-8,16H2,1-5H3,(H,25,29)(H2,26,27,28) |
| InChIKey | NLUGKHUBQNMIMP-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.56 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|