C21H36N4O3 — CID 111298171
3-[[[1-(3,4-diethoxyphenyl)ethylamino]-(ethylamino)methylidene]amino]-N-propylpropanamide (PubChem CID 111298171) has the molecular formula C21H36N4O3 and a molecular weight of 392.54 g/mol. Its IUPAC name is 3-[[[1-(3,4-diethoxyphenyl)ethylamino]-(ethylamino)methylidene]amino]-N-propylpropanamide.
| Compound Name | 3-[[[1-(3,4-diethoxyphenyl)ethylamino]-(ethylamino)methylidene]amino]-N-propylpropanamide |
|---|---|
| PubChem CID | 111298171 |
| Molecular Formula | C21H36N4O3 |
| Molecular Weight | 392.54 g/mol |
| Exact Mass | 392.28 |
| IUPAC Name | 3-[[[1-(3,4-diethoxyphenyl)ethylamino]-(ethylamino)methylidene]amino]-N-propylpropanamide |
| SMILES | CCCNC(=O)CC/N=C(\NCC)NC(C)c1ccc(OCC)c(OCC)c1 |
| InChI | InChI=1S/C21H36N4O3/c1-6-13-23-20(26)12-14-24-21(22-7-2)25-16(5)17-10-11-18(27-8-3)19(15-17)28-9-4/h10-11,15-16H,6-9,12-14H2,1-5H3,(H,23,26)(H2,22,24,25) |
| InChIKey | ZNLYIVGPNKXWPX-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.54 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|