C19H22BrNO3 — CID 2450618
4-bromo-N-[(1R)-1-(3,4-diethoxyphenyl)ethyl]benzamide (PubChem CID 2450618) has the molecular formula C19H22BrNO3 and a molecular weight of 392.29 g/mol. Its IUPAC name is 4-bromo-N-[(1R)-1-(3,4-diethoxyphenyl)ethyl]benzamide.
| Compound Name | 4-bromo-N-[(1R)-1-(3,4-diethoxyphenyl)ethyl]benzamide |
|---|---|
| PubChem CID | 2450618 |
| Molecular Formula | C19H22BrNO3 |
| Molecular Weight | 392.29 g/mol |
| Exact Mass | 391.08 |
| IUPAC Name | 4-bromo-N-[(1R)-1-(3,4-diethoxyphenyl)ethyl]benzamide |
| SMILES | CCOc1ccc([C@@H](C)NC(=O)c2ccc(Br)cc2)cc1OCC |
| InChI | InChI=1S/C19H22BrNO3/c1-4-23-17-11-8-15(12-18(17)24-5-2)13(3)21-19(22)14-6-9-16(20)10-7-14/h6-13H,4-5H2,1-3H3,(H,21,22)/t13-/m1/s1 |
| InChIKey | QMBMJGYHQSBASU-CYBMUJFWSA-N |
| XLogP | 4.74 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.29 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |