C21H27NO3 — CID 7936483
N-[(1S)-1-(3,4-diethoxyphenyl)ethyl]-3,5-dimethylbenzamide (PubChem CID 7936483) has the molecular formula C21H27NO3 and a molecular weight of 341.45 g/mol. Its IUPAC name is N-[(1S)-1-(3,4-diethoxyphenyl)ethyl]-3,5-dimethylbenzamide.
| Compound Name | N-[(1S)-1-(3,4-diethoxyphenyl)ethyl]-3,5-dimethylbenzamide |
|---|---|
| PubChem CID | 7936483 |
| Molecular Formula | C21H27NO3 |
| Molecular Weight | 341.45 g/mol |
| Exact Mass | 341.20 |
| IUPAC Name | N-[(1S)-1-(3,4-diethoxyphenyl)ethyl]-3,5-dimethylbenzamide |
| SMILES | CCOc1ccc([C@H](C)NC(=O)c2cc(C)cc(C)c2)cc1OCC |
| InChI | InChI=1S/C21H27NO3/c1-6-24-19-9-8-17(13-20(19)25-7-2)16(5)22-21(23)18-11-14(3)10-15(4)12-18/h8-13,16H,6-7H2,1-5H3,(H,22,23)/t16-/m0/s1 |
| InChIKey | GLAIZKJCVNPUIO-INIZCTEOSA-N |
| XLogP | 4.59 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.45 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |