C19H22INO3 — CID 27136904
N-[(1R)-1-(3,4-diethoxyphenyl)ethyl]-3-iodobenzamide (PubChem CID 27136904) has the molecular formula C19H22INO3 and a molecular weight of 439.29 g/mol. Its IUPAC name is N-[(1R)-1-(3,4-diethoxyphenyl)ethyl]-3-iodobenzamide.
| Compound Name | N-[(1R)-1-(3,4-diethoxyphenyl)ethyl]-3-iodobenzamide |
|---|---|
| PubChem CID | 27136904 |
| Molecular Formula | C19H22INO3 |
| Molecular Weight | 439.29 g/mol |
| Exact Mass | 439.06 |
| IUPAC Name | N-[(1R)-1-(3,4-diethoxyphenyl)ethyl]-3-iodobenzamide |
| SMILES | CCOc1ccc([C@@H](C)NC(=O)c2cccc(I)c2)cc1OCC |
| InChI | InChI=1S/C19H22INO3/c1-4-23-17-10-9-14(12-18(17)24-5-2)13(3)21-19(22)15-7-6-8-16(20)11-15/h6-13H,4-5H2,1-3H3,(H,21,22)/t13-/m1/s1 |
| InChIKey | HHIOJJVBPKGONT-CYBMUJFWSA-N |
| XLogP | 4.58 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.29 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|