C21H27NO5S — CID 17459758
N-[1-(3,4-diethoxyphenyl)ethyl]-4-(methylsulfonylmethyl)benzamide (PubChem CID 17459758) has the molecular formula C21H27NO5S and a molecular weight of 405.52 g/mol. Its IUPAC name is N-[1-(3,4-diethoxyphenyl)ethyl]-4-(methylsulfonylmethyl)benzamide.
| Compound Name | N-[1-(3,4-diethoxyphenyl)ethyl]-4-(methylsulfonylmethyl)benzamide |
|---|---|
| PubChem CID | 17459758 |
| Molecular Formula | C21H27NO5S |
| Molecular Weight | 405.52 g/mol |
| Exact Mass | 405.16 |
| IUPAC Name | N-[1-(3,4-diethoxyphenyl)ethyl]-4-(methylsulfonylmethyl)benzamide |
| SMILES | CCOc1ccc(C(C)NC(=O)c2ccc(CS(C)(=O)=O)cc2)cc1OCC |
| InChI | InChI=1S/C21H27NO5S/c1-5-26-19-12-11-18(13-20(19)27-6-2)15(3)22-21(23)17-9-7-16(8-10-17)14-28(4,24)25/h7-13,15H,5-6,14H2,1-4H3,(H,22,23) |
| InChIKey | SHKZGXWWSCWBDD-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.52 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |