C23H33FIN3O3 — CID 111297520
1-[1-(3,4-diethoxyphenyl)ethyl]-3-ethyl-2-[2-(4-fluorophenyl)-2-hydroxyethyl]guanidine;hydroiodide (PubChem CID 111297520) has the molecular formula C23H33FIN3O3 and a molecular weight of 545.44 g/mol. Its IUPAC name is 1-[1-(3,4-diethoxyphenyl)ethyl]-3-ethyl-2-[2-(4-fluorophenyl)-2-hydroxyethyl]guanidine;hydroiodide.
| Compound Name | 1-[1-(3,4-diethoxyphenyl)ethyl]-3-ethyl-2-[2-(4-fluorophenyl)-2-hydroxyethyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111297520 |
| Molecular Formula | C23H33FIN3O3 |
| Molecular Weight | 545.44 g/mol |
| Exact Mass | 545.16 |
| IUPAC Name | 1-[1-(3,4-diethoxyphenyl)ethyl]-3-ethyl-2-[2-(4-fluorophenyl)-2-hydroxyethyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\CC(O)c1ccc(F)cc1)NC(C)c1ccc(OCC)c(OCC)c1.I |
| InChI | InChI=1S/C23H32FN3O3.HI/c1-5-25-23(26-15-20(28)17-8-11-19(24)12-9-17)27-16(4)18-10-13-21(29-6-2)22(14-18)30-7-3;/h8-14,16,20,28H,5-7,15H2,1-4H3,(H2,25,26,27);1H |
| InChIKey | VNJZSRODNUXOTJ-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 75.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.44 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|