C23H35N3O4 — CID 111363317
1-[1-(3,4-dipropoxyphenyl)ethyl]-3-ethyl-2-[2-(furan-2-yl)-2-hydroxyethyl]guanidine (PubChem CID 111363317) has the molecular formula C23H35N3O4 and a molecular weight of 417.55 g/mol. Its IUPAC name is 1-[1-(3,4-dipropoxyphenyl)ethyl]-3-ethyl-2-[2-(furan-2-yl)-2-hydroxyethyl]guanidine.
| Compound Name | 1-[1-(3,4-dipropoxyphenyl)ethyl]-3-ethyl-2-[2-(furan-2-yl)-2-hydroxyethyl]guanidine |
|---|---|
| PubChem CID | 111363317 |
| Molecular Formula | C23H35N3O4 |
| Molecular Weight | 417.55 g/mol |
| Exact Mass | 417.26 |
| IUPAC Name | 1-[1-(3,4-dipropoxyphenyl)ethyl]-3-ethyl-2-[2-(furan-2-yl)-2-hydroxyethyl]guanidine |
| SMILES | CCCOc1ccc(C(C)N/C(=N/CC(O)c2ccco2)NCC)cc1OCCC |
| InChI | InChI=1S/C23H35N3O4/c1-5-12-28-21-11-10-18(15-22(21)29-13-6-2)17(4)26-23(24-7-3)25-16-19(27)20-9-8-14-30-20/h8-11,14-15,17,19,27H,5-7,12-13,16H2,1-4H3,(H2,24,25,26) |
| InChIKey | LTGLVHBNPNPAAV-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 88.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.55 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|