C19H27N3O3S — CID 111981369
2-[2-(3,4-dimethoxyphenyl)-2-hydroxyethyl]-1-ethyl-3-(1-thiophen-2-ylethyl)guanidine (PubChem CID 111981369) has the molecular formula C19H27N3O3S and a molecular weight of 377.51 g/mol. Its IUPAC name is 2-[2-(3,4-dimethoxyphenyl)-2-hydroxyethyl]-1-ethyl-3-(1-thiophen-2-ylethyl)guanidine.
| Compound Name | 2-[2-(3,4-dimethoxyphenyl)-2-hydroxyethyl]-1-ethyl-3-(1-thiophen-2-ylethyl)guanidine |
|---|---|
| PubChem CID | 111981369 |
| Molecular Formula | C19H27N3O3S |
| Molecular Weight | 377.51 g/mol |
| Exact Mass | 377.18 |
| IUPAC Name | 2-[2-(3,4-dimethoxyphenyl)-2-hydroxyethyl]-1-ethyl-3-(1-thiophen-2-ylethyl)guanidine |
| SMILES | CCN/C(=N\CC(O)c1ccc(OC)c(OC)c1)NC(C)c1cccs1 |
| InChI | InChI=1S/C19H27N3O3S/c1-5-20-19(22-13(2)18-7-6-10-26-18)21-12-15(23)14-8-9-16(24-3)17(11-14)25-4/h6-11,13,15,23H,5,12H2,1-4H3,(H2,20,21,22) |
| InChIKey | HOVKNKKFKRLCTO-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 75.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.51 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|