C17H22ClN3OS — CID 111331034
2-[2-(4-chlorophenyl)-2-hydroxyethyl]-1-ethyl-3-(1-thiophen-2-ylethyl)guanidine (PubChem CID 111331034) has the molecular formula C17H22ClN3OS and a molecular weight of 351.90 g/mol. Its IUPAC name is 2-[2-(4-chlorophenyl)-2-hydroxyethyl]-1-ethyl-3-(1-thiophen-2-ylethyl)guanidine.
| Compound Name | 2-[2-(4-chlorophenyl)-2-hydroxyethyl]-1-ethyl-3-(1-thiophen-2-ylethyl)guanidine |
|---|---|
| PubChem CID | 111331034 |
| Molecular Formula | C17H22ClN3OS |
| Molecular Weight | 351.90 g/mol |
| Exact Mass | 351.12 |
| IUPAC Name | 2-[2-(4-chlorophenyl)-2-hydroxyethyl]-1-ethyl-3-(1-thiophen-2-ylethyl)guanidine |
| SMILES | CCN/C(=N\CC(O)c1ccc(Cl)cc1)NC(C)c1cccs1 |
| InChI | InChI=1S/C17H22ClN3OS/c1-3-19-17(21-12(2)16-5-4-10-23-16)20-11-15(22)13-6-8-14(18)9-7-13/h4-10,12,15,22H,3,11H2,1-2H3,(H2,19,20,21) |
| InChIKey | WYCSZWZPPHVGER-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 56.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.90 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|