C20H26BrN3O2 — CID 111322218
1-[1-(2-bromophenyl)ethyl]-3-ethyl-2-[2-hydroxy-2-(4-methoxyphenyl)ethyl]guanidine (PubChem CID 111322218) has the molecular formula C20H26BrN3O2 and a molecular weight of 420.35 g/mol. Its IUPAC name is 1-[1-(2-bromophenyl)ethyl]-3-ethyl-2-[2-hydroxy-2-(4-methoxyphenyl)ethyl]guanidine.
| Compound Name | 1-[1-(2-bromophenyl)ethyl]-3-ethyl-2-[2-hydroxy-2-(4-methoxyphenyl)ethyl]guanidine |
|---|---|
| PubChem CID | 111322218 |
| Molecular Formula | C20H26BrN3O2 |
| Molecular Weight | 420.35 g/mol |
| Exact Mass | 419.12 |
| IUPAC Name | 1-[1-(2-bromophenyl)ethyl]-3-ethyl-2-[2-hydroxy-2-(4-methoxyphenyl)ethyl]guanidine |
| SMILES | CCN/C(=N\CC(O)c1ccc(OC)cc1)NC(C)c1ccccc1Br |
| InChI | InChI=1S/C20H26BrN3O2/c1-4-22-20(24-14(2)17-7-5-6-8-18(17)21)23-13-19(25)15-9-11-16(26-3)12-10-15/h5-12,14,19,25H,4,13H2,1-3H3,(H2,22,23,24) |
| InChIKey | OEIJPOZNWUYTCC-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 65.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.35 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|