C15H22F3N3O2 — CID 111125123
1-ethyl-2-[2-hydroxy-2-[4-(trifluoromethoxy)phenyl]ethyl]-3-propan-2-ylguanidine (PubChem CID 111125123) has the molecular formula C15H22F3N3O2 and a molecular weight of 333.35 g/mol. Its IUPAC name is 1-ethyl-2-[2-hydroxy-2-[4-(trifluoromethoxy)phenyl]ethyl]-3-propan-2-ylguanidine.
| Compound Name | 1-ethyl-2-[2-hydroxy-2-[4-(trifluoromethoxy)phenyl]ethyl]-3-propan-2-ylguanidine |
|---|---|
| PubChem CID | 111125123 |
| Molecular Formula | C15H22F3N3O2 |
| Molecular Weight | 333.35 g/mol |
| Exact Mass | 333.17 |
| IUPAC Name | 1-ethyl-2-[2-hydroxy-2-[4-(trifluoromethoxy)phenyl]ethyl]-3-propan-2-ylguanidine |
| SMILES | CCN/C(=N\CC(O)c1ccc(OC(F)(F)F)cc1)NC(C)C |
| InChI | InChI=1S/C15H22F3N3O2/c1-4-19-14(21-10(2)3)20-9-13(22)11-5-7-12(8-6-11)23-15(16,17)18/h5-8,10,13,22H,4,9H2,1-3H3,(H2,19,20,21) |
| InChIKey | VEYJLVMBZPBVLO-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 65.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.35 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|