C16H24F3N3O3 — CID 111237399
1-ethyl-2-[2-hydroxy-2-[4-(trifluoromethoxy)phenyl]ethyl]-3-(1-methoxypropan-2-yl)guanidine (PubChem CID 111237399) has the molecular formula C16H24F3N3O3 and a molecular weight of 363.38 g/mol. Its IUPAC name is 1-ethyl-2-[2-hydroxy-2-[4-(trifluoromethoxy)phenyl]ethyl]-3-(1-methoxypropan-2-yl)guanidine.
| Compound Name | 1-ethyl-2-[2-hydroxy-2-[4-(trifluoromethoxy)phenyl]ethyl]-3-(1-methoxypropan-2-yl)guanidine |
|---|---|
| PubChem CID | 111237399 |
| Molecular Formula | C16H24F3N3O3 |
| Molecular Weight | 363.38 g/mol |
| Exact Mass | 363.18 |
| IUPAC Name | 1-ethyl-2-[2-hydroxy-2-[4-(trifluoromethoxy)phenyl]ethyl]-3-(1-methoxypropan-2-yl)guanidine |
| SMILES | CCN/C(=N\CC(O)c1ccc(OC(F)(F)F)cc1)NC(C)COC |
| InChI | InChI=1S/C16H24F3N3O3/c1-4-20-15(22-11(2)10-24-3)21-9-14(23)12-5-7-13(8-6-12)25-16(17,18)19/h5-8,11,14,23H,4,9-10H2,1-3H3,(H2,20,21,22) |
| InChIKey | HCODYXAXSJIYNB-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 75.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.38 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|