C14H19F3N2O4 — CID 94744564
1-[(2S)-2-hydroxy-2-[4-(trifluoromethoxy)phenyl]ethyl]-3-[(2S)-1-methoxypropan-2-yl]urea (PubChem CID 94744564) has the molecular formula C14H19F3N2O4 and a molecular weight of 336.31 g/mol. Its IUPAC name is 1-[(2S)-2-hydroxy-2-[4-(trifluoromethoxy)phenyl]ethyl]-3-[(2S)-1-methoxypropan-2-yl]urea.
| Compound Name | 1-[(2S)-2-hydroxy-2-[4-(trifluoromethoxy)phenyl]ethyl]-3-[(2S)-1-methoxypropan-2-yl]urea |
|---|---|
| PubChem CID | 94744564 |
| Molecular Formula | C14H19F3N2O4 |
| Molecular Weight | 336.31 g/mol |
| Exact Mass | 336.13 |
| IUPAC Name | 1-[(2S)-2-hydroxy-2-[4-(trifluoromethoxy)phenyl]ethyl]-3-[(2S)-1-methoxypropan-2-yl]urea |
| SMILES | COC[C@H](C)NC(=O)NC[C@@H](O)c1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C14H19F3N2O4/c1-9(8-22-2)19-13(21)18-7-12(20)10-3-5-11(6-4-10)23-14(15,16)17/h3-6,9,12,20H,7-8H2,1-2H3,(H2,18,19,21)/t9-,12+/m0/s1 |
| InChIKey | XNENIBOTDWAWDW-JOYOIKCWSA-N |
| XLogP | 1.95 |
| TPSA | 79.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.31 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |