C14H17F3N2O4 — CID 122011640
4-[[(1S)-1-[4-(trifluoromethoxy)phenyl]ethyl]carbamoylamino]butanoic acid (PubChem CID 122011640) has the molecular formula C14H17F3N2O4 and a molecular weight of 334.29 g/mol. Its IUPAC name is 4-[[(1S)-1-[4-(trifluoromethoxy)phenyl]ethyl]carbamoylamino]butanoic acid.
| Compound Name | 4-[[(1S)-1-[4-(trifluoromethoxy)phenyl]ethyl]carbamoylamino]butanoic acid |
|---|---|
| PubChem CID | 122011640 |
| Molecular Formula | C14H17F3N2O4 |
| Molecular Weight | 334.29 g/mol |
| Exact Mass | 334.11 |
| IUPAC Name | 4-[[(1S)-1-[4-(trifluoromethoxy)phenyl]ethyl]carbamoylamino]butanoic acid |
| SMILES | C[C@H](NC(=O)NCCCC(=O)O)c1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C14H17F3N2O4/c1-9(19-13(22)18-8-2-3-12(20)21)10-4-6-11(7-5-10)23-14(15,16)17/h4-7,9H,2-3,8H2,1H3,(H,20,21)(H2,18,19,22)/t9-/m0/s1 |
| InChIKey | FWNLOBYGBNIDCE-VIFPVBQESA-N |
| XLogP | 2.81 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.29 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|