C11H18N4O3 — CID 106215666
5-[1-(1H-pyrazol-4-yl)ethylcarbamoylamino]pentanoic acid (PubChem CID 106215666) has the molecular formula C11H18N4O3 and a molecular weight of 254.29 g/mol. Its IUPAC name is 5-[1-(1H-pyrazol-4-yl)ethylcarbamoylamino]pentanoic acid.
| Compound Name | 5-[1-(1H-pyrazol-4-yl)ethylcarbamoylamino]pentanoic acid |
|---|---|
| PubChem CID | 106215666 |
| Molecular Formula | C11H18N4O3 |
| Molecular Weight | 254.29 g/mol |
| Exact Mass | 254.14 |
| IUPAC Name | 5-[1-(1H-pyrazol-4-yl)ethylcarbamoylamino]pentanoic acid |
| SMILES | CC(NC(=O)NCCCCC(=O)O)c1cn[nH]c1 |
| InChI | InChI=1S/C11H18N4O3/c1-8(9-6-13-14-7-9)15-11(18)12-5-3-2-4-10(16)17/h6-8H,2-5H2,1H3,(H,13,14)(H,16,17)(H2,12,15,18) |
| InChIKey | APHUIDLFOPPVOR-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 107.11 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.29 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|