C26H38N4O2 — CID 102519107
1-[(1S)-1-phenylethyl]-3-[8-[[(1S)-1-phenylethyl]carbamoylamino]octyl]urea (PubChem CID 102519107) has the molecular formula C26H38N4O2 and a molecular weight of 438.62 g/mol. Its IUPAC name is 1-[(1S)-1-phenylethyl]-3-[8-[[(1S)-1-phenylethyl]carbamoylamino]octyl]urea.
| Compound Name | 1-[(1S)-1-phenylethyl]-3-[8-[[(1S)-1-phenylethyl]carbamoylamino]octyl]urea |
|---|---|
| PubChem CID | 102519107 |
| Molecular Formula | C26H38N4O2 |
| Molecular Weight | 438.62 g/mol |
| Exact Mass | 438.30 |
| IUPAC Name | 1-[(1S)-1-phenylethyl]-3-[8-[[(1S)-1-phenylethyl]carbamoylamino]octyl]urea |
| SMILES | C[C@H](NC(=O)NCCCCCCCCNC(=O)N[C@@H](C)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C26H38N4O2/c1-21(23-15-9-7-10-16-23)29-25(31)27-19-13-5-3-4-6-14-20-28-26(32)30-22(2)24-17-11-8-12-18-24/h7-12,15-18,21-22H,3-6,13-14,19-20H2,1-2H3,(H2,27,29,31)(H2,28,30,32)/t21-,22-/m0/s1 |
| InChIKey | FABMGAKVBHVFBD-VXKWHMMOSA-N |
| XLogP | 5.45 |
| TPSA | 82.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.62 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|