C20H21N3O3 — CID 108889374
1-[3-(1,3-dioxoisoindol-2-yl)propyl]-3-(1-phenylethyl)urea (PubChem CID 108889374) has the molecular formula C20H21N3O3 and a molecular weight of 351.41 g/mol. Its IUPAC name is 1-[3-(1,3-dioxoisoindol-2-yl)propyl]-3-(1-phenylethyl)urea.
| Compound Name | 1-[3-(1,3-dioxoisoindol-2-yl)propyl]-3-(1-phenylethyl)urea |
|---|---|
| PubChem CID | 108889374 |
| Molecular Formula | C20H21N3O3 |
| Molecular Weight | 351.41 g/mol |
| Exact Mass | 351.16 |
| IUPAC Name | 1-[3-(1,3-dioxoisoindol-2-yl)propyl]-3-(1-phenylethyl)urea |
| SMILES | CC(NC(=O)NCCCN1C(=O)c2ccccc2C1=O)c1ccccc1 |
| InChI | InChI=1S/C20H21N3O3/c1-14(15-8-3-2-4-9-15)22-20(26)21-12-7-13-23-18(24)16-10-5-6-11-17(16)19(23)25/h2-6,8-11,14H,7,12-13H2,1H3,(H2,21,22,26) |
| InChIKey | IMILJZGHVVDBRH-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.41 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|