C19H26N4O3 — CID 51726491
1-[3-(2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)propyl]-3-[(1R)-1-phenylethyl]urea (PubChem CID 51726491) has the molecular formula C19H26N4O3 and a molecular weight of 358.44 g/mol. Its IUPAC name is 1-[3-(2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)propyl]-3-[(1R)-1-phenylethyl]urea.
| Compound Name | 1-[3-(2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)propyl]-3-[(1R)-1-phenylethyl]urea |
|---|---|
| PubChem CID | 51726491 |
| Molecular Formula | C19H26N4O3 |
| Molecular Weight | 358.44 g/mol |
| Exact Mass | 358.20 |
| IUPAC Name | 1-[3-(2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)propyl]-3-[(1R)-1-phenylethyl]urea |
| SMILES | C[C@@H](NC(=O)NCCCN1C(=O)NC2(CCCC2)C1=O)c1ccccc1 |
| InChI | InChI=1S/C19H26N4O3/c1-14(15-8-3-2-4-9-15)21-17(25)20-12-7-13-23-16(24)19(22-18(23)26)10-5-6-11-19/h2-4,8-9,14H,5-7,10-13H2,1H3,(H,22,26)(H2,20,21,25)/t14-/m1/s1 |
| InChIKey | NHQZKLIBZSNVIT-CQSZACIVSA-N |
| XLogP | 2.30 |
| TPSA | 90.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.44 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|