C22H25N3O5 — CID 108889393
1-[1-(3,4-dimethoxyphenyl)ethyl]-3-[3-(1,3-dioxoisoindol-2-yl)propyl]urea (PubChem CID 108889393) has the molecular formula C22H25N3O5 and a molecular weight of 411.46 g/mol. Its IUPAC name is 1-[1-(3,4-dimethoxyphenyl)ethyl]-3-[3-(1,3-dioxoisoindol-2-yl)propyl]urea.
| Compound Name | 1-[1-(3,4-dimethoxyphenyl)ethyl]-3-[3-(1,3-dioxoisoindol-2-yl)propyl]urea |
|---|---|
| PubChem CID | 108889393 |
| Molecular Formula | C22H25N3O5 |
| Molecular Weight | 411.46 g/mol |
| Exact Mass | 411.18 |
| IUPAC Name | 1-[1-(3,4-dimethoxyphenyl)ethyl]-3-[3-(1,3-dioxoisoindol-2-yl)propyl]urea |
| SMILES | COc1ccc(C(C)NC(=O)NCCCN2C(=O)c3ccccc3C2=O)cc1OC |
| InChI | InChI=1S/C22H25N3O5/c1-14(15-9-10-18(29-2)19(13-15)30-3)24-22(28)23-11-6-12-25-20(26)16-7-4-5-8-17(16)21(25)27/h4-5,7-10,13-14H,6,11-12H2,1-3H3,(H2,23,24,28) |
| InChIKey | DNLVIULBFKCTEJ-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.46 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|