C15H19N3O3 — CID 108874830
1-butan-2-yl-3-[2-(1,3-dioxoisoindol-2-yl)ethyl]urea (PubChem CID 108874830) has the molecular formula C15H19N3O3 and a molecular weight of 289.33 g/mol. Its IUPAC name is 1-butan-2-yl-3-[2-(1,3-dioxoisoindol-2-yl)ethyl]urea.
| Compound Name | 1-butan-2-yl-3-[2-(1,3-dioxoisoindol-2-yl)ethyl]urea |
|---|---|
| PubChem CID | 108874830 |
| Molecular Formula | C15H19N3O3 |
| Molecular Weight | 289.33 g/mol |
| Exact Mass | 289.14 |
| IUPAC Name | 1-butan-2-yl-3-[2-(1,3-dioxoisoindol-2-yl)ethyl]urea |
| SMILES | CCC(C)NC(=O)NCCN1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C15H19N3O3/c1-3-10(2)17-15(21)16-8-9-18-13(19)11-6-4-5-7-12(11)14(18)20/h4-7,10H,3,8-9H2,1-2H3,(H2,16,17,21) |
| InChIKey | XUXFZKILTFPHGU-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.33 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|